C23H24N2O3S2 — CID 46616248
N-benzyl-N-phenyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 46616248) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-benzyl-N-phenyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-benzyl-N-phenyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46616248 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-benzyl-N-phenyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(C1CCCN(S(=O)(=O)c2cccs2)C1)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3S2/c26-23(20-11-7-15-24(18-20)30(27,28)22-14-8-16-29-22)25(21-12-5-2-6-13-21)17-19-9-3-1-4-10-19/h1-6,8-10,12-14,16,20H,7,11,15,17-18H2 |
| InChIKey | NGXBGYUXURFPLN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |