C19H23BrN2O4S2 — CID 24503267
N-[2-(4-bromophenoxy)ethyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 24503267) has the molecular formula C19H23BrN2O4S2 and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24503267 |
| Molecular Formula | C19H23BrN2O4S2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CN(CCOc1ccc(Br)cc1)C(=O)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C19H23BrN2O4S2/c1-21(11-12-26-17-8-6-16(20)7-9-17)19(23)15-4-2-10-22(14-15)28(24,25)18-5-3-13-27-18/h3,5-9,13,15H,2,4,10-12,14H2,1H3 |
| InChIKey | SEFCBHLITNQVQA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |