C19H30N2O4S2 — CID 70703100
N-(2-hydroxycyclohexyl)-N-propyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 70703100) has the molecular formula C19H30N2O4S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-(2-hydroxycyclohexyl)-N-propyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-hydroxycyclohexyl)-N-propyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 70703100 |
| Molecular Formula | C19H30N2O4S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(2-hydroxycyclohexyl)-N-propyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCCN(C(=O)C1CCCN(S(=O)(=O)c2cccs2)C1)C1CCCCC1O |
| InChI | InChI=1S/C19H30N2O4S2/c1-2-11-21(16-8-3-4-9-17(16)22)19(23)15-7-5-12-20(14-15)27(24,25)18-10-6-13-26-18/h6,10,13,15-17,22H,2-5,7-9,11-12,14H2,1H3 |
| InChIKey | FDQNMRHLFKQKNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |