C16H25N3O4S2 — CID 55414873
N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 55414873) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55414873 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCNC(=O)CN(CC)C(=O)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H25N3O4S2/c1-3-17-14(20)12-18(4-2)16(21)13-7-5-9-19(11-13)25(22,23)15-8-6-10-24-15/h6,8,10,13H,3-5,7,9,11-12H2,1-2H3,(H,17,20) |
| InChIKey | JRIUCMVPGYNRIJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |