C10H12N2O2S3 — CID 112684189
2-[[sulfamoyl(thiophen-2-ylmethyl)amino]methyl]thiophene (PubChem CID 112684189) has the molecular formula C10H12N2O2S3 and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-[[sulfamoyl(thiophen-2-ylmethyl)amino]methyl]thiophene.
| Compound Name | 2-[[sulfamoyl(thiophen-2-ylmethyl)amino]methyl]thiophene |
|---|---|
| PubChem CID | 112684189 |
| Molecular Formula | C10H12N2O2S3 |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-[[sulfamoyl(thiophen-2-ylmethyl)amino]methyl]thiophene |
| SMILES | NS(=O)(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C10H12N2O2S3/c11-17(13,14)12(7-9-3-1-5-15-9)8-10-4-2-6-16-10/h1-6H,7-8H2,(H2,11,13,14) |
| InChIKey | OTXJNBPWXPTCEF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |