C11H19NO2S2 — CID 61395279
N-propan-2-yl-N-(thiophen-2-ylmethyl)propane-2-sulfonamide (PubChem CID 61395279) has the molecular formula C11H19NO2S2 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-propan-2-yl-N-(thiophen-2-ylmethyl)propane-2-sulfonamide.
| Compound Name | N-propan-2-yl-N-(thiophen-2-ylmethyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 61395279 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-propan-2-yl-N-(thiophen-2-ylmethyl)propane-2-sulfonamide |
| SMILES | CC(C)N(Cc1cccs1)S(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H19NO2S2/c1-9(2)12(16(13,14)10(3)4)8-11-6-5-7-15-11/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | LJZSQRJJPZLWQG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |