C12H15N3O4S2 — CID 166390232
5-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 166390232) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 5-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166390232 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 5-[propan-2-yl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | CC(C)N(Cc1cccs1)S(=O)(=O)c1cc(C(=O)O)n[nH]1 |
| InChI | InChI=1S/C12H15N3O4S2/c1-8(2)15(7-9-4-3-5-20-9)21(18,19)11-6-10(12(16)17)13-14-11/h3-6,8H,7H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | ALEJBLLZYLIAIQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |