C12H14N2O4S2 — CID 60951972
4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 60951972) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 60951972 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CCN(Cc1cccs1)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C12H14N2O4S2/c1-2-14(8-9-4-3-5-19-9)20(17,18)10-6-11(12(15)16)13-7-10/h3-7,13H,2,8H2,1H3,(H,15,16) |
| InChIKey | KNUDFDLRDVEDFG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |