C12H12BrNO5S2 — CID 62830397
5-bromo-4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62830397) has the molecular formula C12H12BrNO5S2 and a molecular weight of 394.27 g/mol. Its IUPAC name is 5-bromo-4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62830397 |
| Molecular Formula | C12H12BrNO5S2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | 5-bromo-4-[ethyl(thiophen-2-ylmethyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CCN(Cc1cccs1)S(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C12H12BrNO5S2/c1-2-14(7-8-4-3-5-20-8)21(17,18)10-6-9(12(15)16)19-11(10)13/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | XRSMZYZZRHMFIW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |