C14H17NO5S2 — CID 99775173
5-methyl-4-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 99775173) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 5-methyl-4-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 99775173 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 5-methyl-4-[methyl-[(2S)-1-thiophen-2-ylpropan-2-yl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)N(C)[C@@H](C)Cc1cccs1 |
| InChI | InChI=1S/C14H17NO5S2/c1-9(7-11-5-4-6-21-11)15(3)22(18,19)13-8-12(14(16)17)20-10(13)2/h4-6,8-9H,7H2,1-3H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | GCEMPDAYLYMNEB-VIFPVBQESA-N |
| XLogP | 2.60 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |