C12H13BrClNO2S3 — CID 80580037
5-bromo-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-sulfonamide (PubChem CID 80580037) has the molecular formula C12H13BrClNO2S3 and a molecular weight of 414.80 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80580037 |
| Molecular Formula | C12H13BrClNO2S3 |
| Molecular Weight | 414.80 g/mol |
| Exact Mass | 412.90 |
| IUPAC Name | 5-bromo-4-chloro-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(Cc1cccs1)N(C)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H13BrClNO2S3/c1-8(6-9-4-3-5-18-9)15(2)20(16,17)11-7-10(14)12(13)19-11/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | XOCWHHBNESBQGK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |