C15H18ClNO2S2 — CID 79491521
3-(chloromethyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzenesulfonamide (PubChem CID 79491521) has the molecular formula C15H18ClNO2S2 and a molecular weight of 343.90 g/mol. Its IUPAC name is 3-(chloromethyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzenesulfonamide.
| Compound Name | 3-(chloromethyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 79491521 |
| Molecular Formula | C15H18ClNO2S2 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-(chloromethyl)-N-methyl-N-(1-thiophen-2-ylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(Cc1cccs1)N(C)S(=O)(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C15H18ClNO2S2/c1-12(9-14-6-4-8-20-14)17(2)21(18,19)15-7-3-5-13(10-15)11-16/h3-8,10,12H,9,11H2,1-2H3 |
| InChIKey | BRQKETYVNOHAGG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|