C9H12ClNO2S — CID 2106886
3-(chloromethyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 2106886) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is 3-(chloromethyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-(chloromethyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2106886 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 3-(chloromethyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C9H12ClNO2S/c1-11(2)14(12,13)9-5-3-4-8(6-9)7-10/h3-6H,7H2,1-2H3 |
| InChIKey | VAFVNWAVJPFHBF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|