C12H13NO2S — CID 67469153
N,N-dimethylazulene-5-sulfonamide (PubChem CID 67469153) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is N,N-dimethylazulene-5-sulfonamide.
| Compound Name | N,N-dimethylazulene-5-sulfonamide |
|---|---|
| PubChem CID | 67469153 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | N,N-dimethylazulene-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc2cccc-2c1 |
| InChI | InChI=1S/C12H13NO2S/c1-13(2)16(14,15)12-8-4-6-10-5-3-7-11(10)9-12/h3-9H,1-2H3 |
| InChIKey | BNUJLQQKVHEGAC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |