About CID 71291795
CID 71291795 (PubChem CID 71291795) has the molecular formula C9H13BNO2S
and a molecular weight of 210.09 g/mol.
Molecular Properties
| Compound Name | CID 71291795 |
| PubChem CID | 71291795 |
| Molecular Formula | C9H13BNO2S |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | — |
| SMILES | C[B]c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C9H13BNO2S/c1-10-8-5-4-6-9(7-8)14(12,13)11(2)3/h4-7H,1-3H3 |
| InChIKey | OHXBHGHMALFADY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71291795 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71291795?
The IUPAC name of CID 71291795 (CID 71291795) is not available.
What is the SMILES notation for CID 71291795?
The canonical SMILES for CID 71291795 is C[B]c1cccc(S(=O)(=O)N(C)C)c1.
What is the InChIKey of CID 71291795?
The InChIKey is OHXBHGHMALFADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BNO2S/c1-10-8-5-4-6-9(7-8)14(12,13)11(2)3/h4-7H,1-3H3.
What are the key properties of CID 71291795?
CID 71291795 has a molecular weight of 210.09 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71291795 is sourced from PubChem (CID 71291795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).