C8H11Cl2NO2S — CID 142417239
3-chloro-N,N-dimethylbenzenesulfonamide;hydrochloride (PubChem CID 142417239) has the molecular formula C8H11Cl2NO2S and a molecular weight of 256.15 g/mol. Its IUPAC name is 3-chloro-N,N-dimethylbenzenesulfonamide;hydrochloride.
| Compound Name | 3-chloro-N,N-dimethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142417239 |
| Molecular Formula | C8H11Cl2NO2S |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 3-chloro-N,N-dimethylbenzenesulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C8H10ClNO2S.ClH/c1-10(2)13(11,12)8-5-3-4-7(9)6-8;/h3-6H,1-2H3;1H |
| InChIKey | LMDYYHAWLRLEAZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |