C8H9ClFNO2S — CID 697776
3-chloro-4-fluoro-N,N-dimethylbenzenesulfonamide (PubChem CID 697776) has the molecular formula C8H9ClFNO2S and a molecular weight of 237.68 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-chloro-4-fluoro-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 697776 |
| Molecular Formula | C8H9ClFNO2S |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 3-chloro-4-fluoro-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C8H9ClFNO2S/c1-11(2)14(12,13)6-3-4-8(10)7(9)5-6/h3-5H,1-2H3 |
| InChIKey | ZXYMYAGGEHXBMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |