C14H14ClFN2O4S2 — CID 8603687
3-chloro-N-[4-(dimethylsulfamoyl)phenyl]-4-fluorobenzenesulfonamide (PubChem CID 8603687) has the molecular formula C14H14ClFN2O4S2 and a molecular weight of 392.86 g/mol. Its IUPAC name is 3-chloro-N-[4-(dimethylsulfamoyl)phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[4-(dimethylsulfamoyl)phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8603687 |
| Molecular Formula | C14H14ClFN2O4S2 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 3-chloro-N-[4-(dimethylsulfamoyl)phenyl]-4-fluorobenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C14H14ClFN2O4S2/c1-18(2)24(21,22)11-5-3-10(4-6-11)17-23(19,20)12-7-8-14(16)13(15)9-12/h3-9,17H,1-2H3 |
| InChIKey | NEPFTRJORHQWQX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |