C9H13NO2S2 — CID 149258348
N,N-dimethyl-3-methylsulfanylbenzenesulfonamide (PubChem CID 149258348) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is N,N-dimethyl-3-methylsulfanylbenzenesulfonamide.
| Compound Name | N,N-dimethyl-3-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 149258348 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | N,N-dimethyl-3-methylsulfanylbenzenesulfonamide |
| SMILES | CSc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C9H13NO2S2/c1-10(2)14(11,12)9-6-4-5-8(7-9)13-3/h4-7H,1-3H3 |
| InChIKey | XOTKNCLMCPOSKD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |