C8H10N4O6S2 — CID 89277792
1-N,3-N-dimethyl-1-N,3-N-dinitrosobenzene-1,3-disulfonamide (PubChem CID 89277792) has the molecular formula C8H10N4O6S2 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-1-N,3-N-dinitrosobenzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-dimethyl-1-N,3-N-dinitrosobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 89277792 |
| Molecular Formula | C8H10N4O6S2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 1-N,3-N-dimethyl-1-N,3-N-dinitrosobenzene-1,3-disulfonamide |
| SMILES | CN(N=O)S(=O)(=O)c1cccc(S(=O)(=O)N(C)N=O)c1 |
| InChI | InChI=1S/C8H10N4O6S2/c1-11(9-13)19(15,16)7-4-3-5-8(6-7)20(17,18)12(2)10-14/h3-6H,1-2H3 |
| InChIKey | SHDJFBDLLQOGRM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 133.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|