C10H11NO2S — CID 129210848
3-ethynyl-N,N-dimethylbenzenesulfonamide (PubChem CID 129210848) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-ethynyl-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-ethynyl-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 129210848 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-ethynyl-N,N-dimethylbenzenesulfonamide |
| SMILES | C#Cc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C10H11NO2S/c1-4-9-6-5-7-10(8-9)14(12,13)11(2)3/h1,5-8H,2-3H3 |
| InChIKey | IUJSIQFVHKLKIU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|