C6H4Cl4N2O4S2 — CID 19375340
1-N,1-N,3-N,3-N-tetrachlorobenzene-1,3-disulfonamide (PubChem CID 19375340) has the molecular formula C6H4Cl4N2O4S2 and a molecular weight of 374.05 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrachlorobenzene-1,3-disulfonamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetrachlorobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 19375340 |
| Molecular Formula | C6H4Cl4N2O4S2 |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 371.84 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrachlorobenzene-1,3-disulfonamide |
| SMILES | O=S(=O)(c1cccc(S(=O)(=O)N(Cl)Cl)c1)N(Cl)Cl |
| InChI | InChI=1S/C6H4Cl4N2O4S2/c7-11(8)17(13,14)5-2-1-3-6(4-5)18(15,16)12(9)10/h1-4H |
| InChIKey | TZQGSHRFDOTJQQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|