C7H8Cl2NNaO2S — CID 173126628
sodium;N,N-dichloro-4-methylbenzenesulfonamide;hydride (PubChem CID 173126628) has the molecular formula C7H8Cl2NNaO2S and a molecular weight of 264.11 g/mol. Its IUPAC name is sodium;N,N-dichloro-4-methylbenzenesulfonamide;hydride.
| Compound Name | sodium;N,N-dichloro-4-methylbenzenesulfonamide;hydride |
|---|---|
| PubChem CID | 173126628 |
| Molecular Formula | C7H8Cl2NNaO2S |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | sodium;N,N-dichloro-4-methylbenzenesulfonamide;hydride |
| SMILES | Cc1ccc(S(=O)(=O)N(Cl)Cl)cc1.[H-].[Na+] |
| InChI | InChI=1S/C7H7Cl2NO2S.Na.H/c1-6-2-4-7(5-3-6)13(11,12)10(8)9;;/h2-5H,1H3;;/q;+1;-1 |
| InChIKey | ASTGLCZXMTZNIR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|