C29H28N2O9S4 — CID 91209973
1,1,3,3-tetrakis-(4-methylphenyl)sulfonylurea (PubChem CID 91209973) has the molecular formula C29H28N2O9S4 and a molecular weight of 676.82 g/mol. Its IUPAC name is 1,1,3,3-tetrakis-(4-methylphenyl)sulfonylurea.
| Compound Name | 1,1,3,3-tetrakis-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 91209973 |
| Molecular Formula | C29H28N2O9S4 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.07 |
| IUPAC Name | 1,1,3,3-tetrakis-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)N(S(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O9S4/c1-21-5-13-25(14-6-21)41(33,34)30(42(35,36)26-15-7-22(2)8-16-26)29(32)31(43(37,38)27-17-9-23(3)10-18-27)44(39,40)28-19-11-24(4)12-20-28/h5-20H,1-4H3 |
| InChIKey | LFJYESSLHNZKPT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 160.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |