C9H13NO2S3 — CID 122393288
4-methyl-N,N-bis(sulfanylmethyl)benzenesulfonamide (PubChem CID 122393288) has the molecular formula C9H13NO2S3 and a molecular weight of 263.41 g/mol. Its IUPAC name is 4-methyl-N,N-bis(sulfanylmethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N,N-bis(sulfanylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122393288 |
| Molecular Formula | C9H13NO2S3 |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 4-methyl-N,N-bis(sulfanylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CS)CS)cc1 |
| InChI | InChI=1S/C9H13NO2S3/c1-8-2-4-9(5-3-8)15(11,12)10(6-13)7-14/h2-5,13-14H,6-7H2,1H3 |
| InChIKey | TYELEDXSDBEKIF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|