C11H15F2NO6S3 — CID 2829825
2-[2-fluorosulfonylethyl-(4-methylphenyl)sulfonylamino]ethanesulfonyl fluoride (PubChem CID 2829825) has the molecular formula C11H15F2NO6S3 and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[2-fluorosulfonylethyl-(4-methylphenyl)sulfonylamino]ethanesulfonyl fluoride.
| Compound Name | 2-[2-fluorosulfonylethyl-(4-methylphenyl)sulfonylamino]ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 2829825 |
| Molecular Formula | C11H15F2NO6S3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 2-[2-fluorosulfonylethyl-(4-methylphenyl)sulfonylamino]ethanesulfonyl fluoride |
| SMILES | Cc1ccc(S(=O)(=O)N(CCS(=O)(=O)F)CCS(=O)(=O)F)cc1 |
| InChI | InChI=1S/C11H15F2NO6S3/c1-10-2-4-11(5-3-10)23(19,20)14(6-8-21(12,15)16)7-9-22(13,17)18/h2-5H,6-9H2,1H3 |
| InChIKey | UJHKJTBZDLDNIP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |