C29H41NO2SSi2 — CID 102584689
4-methyl-N,N-bis(5-triethylsilylpenta-2,4-diynyl)benzenesulfonamide (PubChem CID 102584689) has the molecular formula C29H41NO2SSi2 and a molecular weight of 523.89 g/mol. Its IUPAC name is 4-methyl-N,N-bis(5-triethylsilylpenta-2,4-diynyl)benzenesulfonamide.
| Compound Name | 4-methyl-N,N-bis(5-triethylsilylpenta-2,4-diynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102584689 |
| Molecular Formula | C29H41NO2SSi2 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-methyl-N,N-bis(5-triethylsilylpenta-2,4-diynyl)benzenesulfonamide |
| SMILES | CC[Si](C#CC#CCN(CC#CC#C[Si](CC)(CC)CC)S(=O)(=O)c1ccc(C)cc1)(CC)CC |
| InChI | InChI=1S/C29H41NO2SSi2/c1-8-34(9-2,10-3)26-18-14-16-24-30(33(31,32)29-22-20-28(7)21-23-29)25-17-15-19-27-35(11-4,12-5)13-6/h20-23H,8-13,24-25H2,1-7H3 |
| InChIKey | MMWKKZBVQSRTLG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|