C16H17NO3S — CID 42599302
4-methyl-N-(6-oxohex-2-ynyl)-N-prop-2-ynylbenzenesulfonamide (PubChem CID 42599302) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-methyl-N-(6-oxohex-2-ynyl)-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-methyl-N-(6-oxohex-2-ynyl)-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 42599302 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-methyl-N-(6-oxohex-2-ynyl)-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC#CCCC=O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17NO3S/c1-3-12-17(13-6-4-5-7-14-18)21(19,20)16-10-8-15(2)9-11-16/h1,8-11,14H,5,7,12-13H2,2H3 |
| InChIKey | AZHWOOSDQIRMBC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|