C17H22ClNO2S — CID 10871520
N-(4-chlorobut-2-ynyl)-N-[(Z)-hex-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 10871520) has the molecular formula C17H22ClNO2S and a molecular weight of 339.89 g/mol. Its IUPAC name is N-(4-chlorobut-2-ynyl)-N-[(Z)-hex-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(4-chlorobut-2-ynyl)-N-[(Z)-hex-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10871520 |
| Molecular Formula | C17H22ClNO2S |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(4-chlorobut-2-ynyl)-N-[(Z)-hex-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | CCC/C=C\CN(CC#CCCl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22ClNO2S/c1-3-4-5-7-14-19(15-8-6-13-18)22(20,21)17-11-9-16(2)10-12-17/h5,7,9-12H,3-4,13-15H2,1-2H3/b7-5- |
| InChIKey | KELAJTGDNTUITK-ALCCZGGFSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|