C14H22ClNO2S2 — CID 5358535
(E)-hex-2-ene;[methyl-(4-methylphenyl)sulfonylamino] thiohypochlorite (PubChem CID 5358535) has the molecular formula C14H22ClNO2S2 and a molecular weight of 335.92 g/mol. Its IUPAC name is (E)-hex-2-ene;[methyl-(4-methylphenyl)sulfonylamino] thiohypochlorite.
| Compound Name | (E)-hex-2-ene;[methyl-(4-methylphenyl)sulfonylamino] thiohypochlorite |
|---|---|
| PubChem CID | 5358535 |
| Molecular Formula | C14H22ClNO2S2 |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (E)-hex-2-ene;[methyl-(4-methylphenyl)sulfonylamino] thiohypochlorite |
| SMILES | C/C=C/CCC.Cc1ccc(S(=O)(=O)N(C)SCl)cc1 |
| InChI | InChI=1S/C8H10ClNO2S2.C6H12/c1-7-3-5-8(6-4-7)14(11,12)10(2)13-9;1-3-5-6-4-2/h3-6H,1-2H3;3,5H,4,6H2,1-2H3/b;5-3+ |
| InChIKey | RUGUKEYPIHDBKY-GWDXERMASA-N |
| XLogP | 4.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|