C12H18N2O2S — CID 15562356
N,4-dimethyl-N-[(E)-2-methylpropylideneamino]benzenesulfonamide (PubChem CID 15562356) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is N,4-dimethyl-N-[(E)-2-methylpropylideneamino]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[(E)-2-methylpropylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 15562356 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N,4-dimethyl-N-[(E)-2-methylpropylideneamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)/N=C/C(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-10(2)9-13-14(4)17(15,16)12-7-5-11(3)6-8-12/h5-10H,1-4H3/b13-9+ |
| InChIKey | JQIHHWXYBVOHTD-UKTHLTGXSA-N |
| XLogP | 2.26 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|