C29H42O3S — CID 87495296
(3Z,6Z,9Z,12Z,15Z,18Z)-docosa-3,6,9,12,15,18-hexaene;4-methylbenzenesulfonic acid (PubChem CID 87495296) has the molecular formula C29H42O3S and a molecular weight of 470.72 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z,18Z)-docosa-3,6,9,12,15,18-hexaene;4-methylbenzenesulfonic acid.
| Compound Name | (3Z,6Z,9Z,12Z,15Z,18Z)-docosa-3,6,9,12,15,18-hexaene;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87495296 |
| Molecular Formula | C29H42O3S |
| Molecular Weight | 470.72 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z,18Z)-docosa-3,6,9,12,15,18-hexaene;4-methylbenzenesulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H34.C7H8O3S/c1-3-5-7-9-11-13-15-17-19-21-22-20-18-16-14-12-10-8-6-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h5,7-8,10-11,13-14,16-17,19-20,22H,3-4,6,9,12,15,18,21H2,1-2H3;2-5H,1H3,(H,8,9,10)/b7-5-,10-8-,13-11-,16-14-,19-17-,22-20-; |
| InChIKey | XENUBUJQIOJPBA-UACOSSHPSA-N |
| XLogP | 8.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.72 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|