C21H22ClNO3S — CID 102160955
N-[(E)-but-2-enyl]-N-[4-(4-chlorophenyl)-4-hydroxybut-2-ynyl]-4-methylbenzenesulfonamide (PubChem CID 102160955) has the molecular formula C21H22ClNO3S and a molecular weight of 403.93 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-N-[4-(4-chlorophenyl)-4-hydroxybut-2-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-but-2-enyl]-N-[4-(4-chlorophenyl)-4-hydroxybut-2-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102160955 |
| Molecular Formula | C21H22ClNO3S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(E)-but-2-enyl]-N-[4-(4-chlorophenyl)-4-hydroxybut-2-ynyl]-4-methylbenzenesulfonamide |
| SMILES | C/C=C/CN(CC#CC(O)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22ClNO3S/c1-3-4-15-23(27(25,26)20-13-7-17(2)8-14-20)16-5-6-21(24)18-9-11-19(22)12-10-18/h3-4,7-14,21,24H,15-16H2,1-2H3/b4-3+ |
| InChIKey | IVKZXFBOBGFIGK-ONEGZZNKSA-N |
| XLogP | 3.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|