C19H19NO2S — CID 122402009
4-methyl-N-[(E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enyl]-N-prop-2-ynylbenzenesulfonamide (PubChem CID 122402009) has the molecular formula C19H19NO2S and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-methyl-N-[(E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enyl]-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enyl]-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 122402009 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-methyl-N-[(E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enyl]-N-prop-2-ynylbenzenesulfonamide |
| SMILES | [2H]c1c([2H])c([2H])c(/C=C/CN(CC#C)S(=O)(=O)c2ccc(C)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C19H19NO2S/c1-3-15-20(16-7-10-18-8-5-4-6-9-18)23(21,22)19-13-11-17(2)12-14-19/h1,4-14H,15-16H2,2H3/b10-7+/i4D,5D,6D,8D,9D |
| InChIKey | RPSOKXVCPNBLRU-HHACQMFLSA-N |
| XLogP | 3.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|