C19H19BrFNO2S — CID 163210393
N-(2-bromoprop-2-enyl)-N-[(E)-3-(4-fluorophenyl)prop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 163210393) has the molecular formula C19H19BrFNO2S and a molecular weight of 424.34 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N-[(E)-3-(4-fluorophenyl)prop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2-bromoprop-2-enyl)-N-[(E)-3-(4-fluorophenyl)prop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 163210393 |
| Molecular Formula | C19H19BrFNO2S |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N-[(E)-3-(4-fluorophenyl)prop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(Br)CN(C/C=C/c1ccc(F)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19BrFNO2S/c1-15-5-11-19(12-6-15)25(23,24)22(14-16(2)20)13-3-4-17-7-9-18(21)10-8-17/h3-12H,2,13-14H2,1H3/b4-3+ |
| InChIKey | MNWWIDLMBKKNFK-ONEGZZNKSA-N |
| XLogP | 4.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |