C22H19FN3O2S+ — CID 154709950
2-[[(E)-3-(4-fluorophenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium (PubChem CID 154709950) has the molecular formula C22H19FN3O2S+ and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[[(E)-3-(4-fluorophenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium.
| Compound Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium |
|---|---|
| PubChem CID | 154709950 |
| Molecular Formula | C22H19FN3O2S+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[[(E)-3-(4-fluorophenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium |
| SMILES | Cc1ccc(S(=O)(=O)N(C/C=C/c2ccc(F)cc2)c2ccccc2[N+]#N)cc1 |
| InChI | InChI=1S/C22H19FN3O2S/c1-17-8-14-20(15-9-17)29(27,28)26(22-7-3-2-6-21(22)25-24)16-4-5-18-10-12-19(23)13-11-18/h2-15H,16H2,1H3/q+1/b5-4+ |
| InChIKey | VLRRQUPTIAKDLW-SNAWJCMRSA-N |
| XLogP | 5.53 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|