C23H22N3O2S+ — CID 154710071
2-[[(E)-3-(3-methylphenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium (PubChem CID 154710071) has the molecular formula C23H22N3O2S+ and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[[(E)-3-(3-methylphenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium.
| Compound Name | 2-[[(E)-3-(3-methylphenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium |
|---|---|
| PubChem CID | 154710071 |
| Molecular Formula | C23H22N3O2S+ |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[[(E)-3-(3-methylphenyl)prop-2-enyl]-(4-methylphenyl)sulfonylamino]benzenediazonium |
| SMILES | Cc1ccc(S(=O)(=O)N(C/C=C/c2cccc(C)c2)c2ccccc2[N+]#N)cc1 |
| InChI | InChI=1S/C23H22N3O2S/c1-18-12-14-21(15-13-18)29(27,28)26(23-11-4-3-10-22(23)25-24)16-6-9-20-8-5-7-19(2)17-20/h3-15,17H,16H2,1-2H3/q+1/b9-6+ |
| InChIKey | MRPPFVVZLZWVQH-RMKNXTFCSA-N |
| XLogP | 5.70 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|