C24H20F3NO3S — CID 169040724
N-[3-formyl-4-(trifluoromethyl)phenyl]-4-methyl-N-(3-phenylprop-2-enyl)benzenesulfonamide (PubChem CID 169040724) has the molecular formula C24H20F3NO3S and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[3-formyl-4-(trifluoromethyl)phenyl]-4-methyl-N-(3-phenylprop-2-enyl)benzenesulfonamide.
| Compound Name | N-[3-formyl-4-(trifluoromethyl)phenyl]-4-methyl-N-(3-phenylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 169040724 |
| Molecular Formula | C24H20F3NO3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-[3-formyl-4-(trifluoromethyl)phenyl]-4-methyl-N-(3-phenylprop-2-enyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC=Cc2ccccc2)c2ccc(C(F)(F)F)c(C=O)c2)cc1 |
| InChI | InChI=1S/C24H20F3NO3S/c1-18-9-12-22(13-10-18)32(30,31)28(15-5-8-19-6-3-2-4-7-19)21-11-14-23(24(25,26)27)20(16-21)17-29/h2-14,16-17H,15H2,1H3 |
| InChIKey | XOEONMJJRXJQBN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|