C24H19F6N3O3S — CID 124535099
2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 124535099) has the molecular formula C24H19F6N3O3S and a molecular weight of 543.49 g/mol. Its IUPAC name is 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124535099 |
| Molecular Formula | C24H19F6N3O3S |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccccc2C(F)(F)F)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H19F6N3O3S/c1-16-9-11-20(12-10-16)37(35,36)33(19-7-4-6-18(13-19)23(25,26)27)15-22(34)32-31-14-17-5-2-3-8-21(17)24(28,29)30/h2-14H,15H2,1H3,(H,32,34)/b31-14- |
| InChIKey | YHHWWLAVPOYMIL-AQLQTECXSA-N |
| XLogP | 5.38 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|