C29H30F3N3O6S — CID 124535033
tert-butyl 2-[4-[(Z)-[[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 124535033) has the molecular formula C29H30F3N3O6S and a molecular weight of 605.64 g/mol. Its IUPAC name is tert-butyl 2-[4-[(Z)-[[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(Z)-[[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 124535033 |
| Molecular Formula | C29H30F3N3O6S |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | tert-butyl 2-[4-[(Z)-[[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)OC(C)(C)C)cc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H30F3N3O6S/c1-20-8-14-25(15-9-20)42(38,39)35(23-7-5-6-22(16-23)29(30,31)32)18-26(36)34-33-17-21-10-12-24(13-11-21)40-19-27(37)41-28(2,3)4/h5-17H,18-19H2,1-4H3,(H,34,36)/b33-17- |
| InChIKey | AGZYNFOEYPSKEE-FZPRHHONSA-N |
| XLogP | 5.08 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|