C28H32N4O5S — CID 124535450
2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124535450) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is 2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124535450 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)NC(C)C)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H32N4O5S/c1-20(2)30-28(34)19-37-25-12-10-23(11-13-25)17-29-31-27(33)18-32(24-7-5-6-22(4)16-24)38(35,36)26-14-8-21(3)9-15-26/h5-17,20H,18-19H2,1-4H3,(H,30,34)(H,31,33)/b29-17- |
| InChIKey | UFDXKYBLPRNXPC-RHANQZHGSA-N |
| XLogP | 3.55 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|