C29H34N4O5S — CID 124535404
2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124535404) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124535404 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-[4-[2-oxo-2-(propan-2-ylamino)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)NC(C)C)cc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C29H34N4O5S/c1-20(2)31-29(35)19-38-25-11-9-24(10-12-25)17-30-32-28(34)18-33(27-15-8-22(4)16-23(27)5)39(36,37)26-13-6-21(3)7-14-26/h6-17,20H,18-19H2,1-5H3,(H,31,35)(H,32,34)/b30-17- |
| InChIKey | QSPSICLARONYJR-LQNQUEJISA-N |
| XLogP | 3.86 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|