C31H36N4O5S — CID 43878631
2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide (PubChem CID 43878631) has the molecular formula C31H36N4O5S and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 43878631 |
| Molecular Formula | C31H36N4O5S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-(2,4-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(E)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C/c2ccc(OCC(=O)N3CCCCC3)cc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C31H36N4O5S/c1-23-7-14-28(15-8-23)41(38,39)35(29-16-9-24(2)19-25(29)3)21-30(36)33-32-20-26-10-12-27(13-11-26)40-22-31(37)34-17-5-4-6-18-34/h7-16,19-20H,4-6,17-18,21-22H2,1-3H3,(H,33,36)/b32-20+ |
| InChIKey | RCWIOUXAJGRUTM-UZWMFBFFSA-N |
| XLogP | 4.35 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|