C30H28BrN3O4S — CID 3108706
2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 3108706) has the molecular formula C30H28BrN3O4S and a molecular weight of 606.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3108706 |
| Molecular Formula | C30H28BrN3O4S |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-[[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)NN=Cc2ccc(OCc3ccc(Br)cc3)cc2)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H28BrN3O4S/c1-22-8-17-29(23(2)18-22)34(39(36,37)28-6-4-3-5-7-28)20-30(35)33-32-19-24-11-15-27(16-12-24)38-21-25-9-13-26(31)14-10-25/h3-19H,20-21H2,1-2H3,(H,33,35) |
| InChIKey | NIKBMFVNCSGMHW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|