C25H32N4O5S — CID 126032698
2-(4-ethyl-N-methylsulfonylanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126032698) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-(4-ethyl-N-methylsulfonylanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126032698 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-(4-ethyl-N-methylsulfonylanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CCc1ccc(N(CC(=O)N/N=C\c2ccc(OCC(=O)N3CCCCC3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H32N4O5S/c1-3-20-7-11-22(12-8-20)29(35(2,32)33)18-24(30)27-26-17-21-9-13-23(14-10-21)34-19-25(31)28-15-5-4-6-16-28/h7-14,17H,3-6,15-16,18-19H2,1-2H3,(H,27,30)/b26-17- |
| InChIKey | IAWXJBTYGHPLJW-ONUIUJJFSA-N |
| XLogP | 2.56 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|