C23H27N5O7S — CID 126030817
2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126030817) has the molecular formula C23H27N5O7S and a molecular weight of 517.56 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126030817 |
| Molecular Formula | C23H27N5O7S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(OCC(=O)N2CCCCC2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N5O7S/c1-36(33,34)27(19-6-5-7-20(14-19)28(31)32)16-22(29)25-24-15-18-8-10-21(11-9-18)35-17-23(30)26-12-3-2-4-13-26/h5-11,14-15H,2-4,12-13,16-17H2,1H3,(H,25,29)/b24-15- |
| InChIKey | CFNDVZPDWZKELP-IWIPYMOSSA-N |
| XLogP | 1.90 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|