C17H18N4O6S — CID 43879651
2-(4-methoxy-N-methylsulfonylanilino)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 43879651) has the molecular formula C17H18N4O6S and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-(4-methoxy-N-methylsulfonylanilino)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-methoxy-N-methylsulfonylanilino)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43879651 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-(4-methoxy-N-methylsulfonylanilino)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18N4O6S/c1-27-16-9-7-14(8-10-16)20(28(2,25)26)12-17(22)19-18-11-13-3-5-15(6-4-13)21(23)24/h3-11H,12H2,1-2H3,(H,19,22)/b18-11+ |
| InChIKey | QCUKRILWSKNKCD-WOJGMQOQSA-N |
| XLogP | 1.52 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|