C32H38N4O6S — CID 126189913
N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 126189913) has the molecular formula C32H38N4O6S and a molecular weight of 606.75 g/mol. Its IUPAC name is N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 126189913 |
| Molecular Formula | C32H38N4O6S |
| Molecular Weight | 606.75 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | N-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCC(=O)NC3CCCCC3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H38N4O6S/c1-3-41-28-17-19-30(20-18-28)43(39,40)36(27-13-9-24(2)10-14-27)22-31(37)35-33-21-25-11-15-29(16-12-25)42-23-32(38)34-26-7-5-4-6-8-26/h9-21,26H,3-8,22-23H2,1-2H3,(H,34,38)(H,35,37)/b33-21- |
| InChIKey | FGYXOGNYHKTVSH-HWIUFGAZSA-N |
| XLogP | 4.57 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|