C30H29F3N4O3S — CID 3128302
N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 3128302) has the molecular formula C30H29F3N4O3S and a molecular weight of 582.65 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3128302 |
| Molecular Formula | C30H29F3N4O3S |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-2-(4-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(N(CC(=O)NN=Cc2cc(C)n(-c3ccccc3C(F)(F)F)c2C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H29F3N4O3S/c1-20-9-13-25(14-10-20)36(41(39,40)26-15-11-21(2)12-16-26)19-29(38)35-34-18-24-17-22(3)37(23(24)4)28-8-6-5-7-27(28)30(31,32)33/h5-18H,19H2,1-4H3,(H,35,38) |
| InChIKey | ARCRTXUKRXLWCQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|