C30H25NO2S — CID 177481573
4-methyl-N-[2-(2-phenylethynyl)phenyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide (PubChem CID 177481573) has the molecular formula C30H25NO2S and a molecular weight of 463.60 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-phenylethynyl)phenyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(2-phenylethynyl)phenyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 177481573 |
| Molecular Formula | C30H25NO2S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-methyl-N-[2-(2-phenylethynyl)phenyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C/C=C/c2ccccc2)c2ccccc2C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H25NO2S/c1-25-18-22-29(23-19-25)34(32,33)31(24-10-15-26-11-4-2-5-12-26)30-17-9-8-16-28(30)21-20-27-13-6-3-7-14-27/h2-19,22-23H,24H2,1H3/b15-10+ |
| InChIKey | ULLFDBODWRNKCE-XNTDXEJSSA-N |
| XLogP | 6.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|